C16H18Cl2N2O — CID 66198156
5-(cyclohexylmethyl)-4-(2,4-dichlorophenyl)-1,2-oxazol-3-amine (PubChem CID 66198156) has the molecular formula C16H18Cl2N2O and a molecular weight of 325.24 g/mol. Its IUPAC name is 5-(cyclohexylmethyl)-4-(2,4-dichlorophenyl)-1,2-oxazol-3-amine.
| Compound Name | 5-(cyclohexylmethyl)-4-(2,4-dichlorophenyl)-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 66198156 |
| Molecular Formula | C16H18Cl2N2O |
| Molecular Weight | 325.24 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 5-(cyclohexylmethyl)-4-(2,4-dichlorophenyl)-1,2-oxazol-3-amine |
| SMILES | Nc1noc(CC2CCCCC2)c1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H18Cl2N2O/c17-11-6-7-12(13(18)9-11)15-14(21-20-16(15)19)8-10-4-2-1-3-5-10/h6-7,9-10H,1-5,8H2,(H2,19,20) |
| InChIKey | MPHKBKPNRDNKFT-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.24 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |