C9H14N2OS — CID 105451723
3-methyl-4-(thian-3-yl)-1,2-oxazol-5-amine (PubChem CID 105451723) has the molecular formula C9H14N2OS and a molecular weight of 198.29 g/mol. Its IUPAC name is 3-methyl-4-(thian-3-yl)-1,2-oxazol-5-amine.
| Compound Name | 3-methyl-4-(thian-3-yl)-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 105451723 |
| Molecular Formula | C9H14N2OS |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 3-methyl-4-(thian-3-yl)-1,2-oxazol-5-amine |
| SMILES | Cc1noc(N)c1C1CCCSC1 |
| InChI | InChI=1S/C9H14N2OS/c1-6-8(9(10)12-11-6)7-3-2-4-13-5-7/h7H,2-5,10H2,1H3 |
| InChIKey | IZYXMRYLXCGVMK-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |