C13H20N2S2 — CID 114283153
2-cyclopentyl-4-(thian-3-yl)-1,3-thiazol-5-amine (PubChem CID 114283153) has the molecular formula C13H20N2S2 and a molecular weight of 268.45 g/mol. Its IUPAC name is 2-cyclopentyl-4-(thian-3-yl)-1,3-thiazol-5-amine.
| Compound Name | 2-cyclopentyl-4-(thian-3-yl)-1,3-thiazol-5-amine |
|---|---|
| PubChem CID | 114283153 |
| Molecular Formula | C13H20N2S2 |
| Molecular Weight | 268.45 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 2-cyclopentyl-4-(thian-3-yl)-1,3-thiazol-5-amine |
| SMILES | Nc1sc(C2CCCC2)nc1C1CCCSC1 |
| InChI | InChI=1S/C13H20N2S2/c14-12-11(10-6-3-7-16-8-10)15-13(17-12)9-4-1-2-5-9/h9-10H,1-8,14H2 |
| InChIKey | LOZZUMFMOWDFOJ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.45 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |