C11H16N2S — CID 62077032
2-cyclopentyl-4-cyclopropyl-1,3-thiazol-5-amine (PubChem CID 62077032) has the molecular formula C11H16N2S and a molecular weight of 208.33 g/mol. Its IUPAC name is 2-cyclopentyl-4-cyclopropyl-1,3-thiazol-5-amine.
| Compound Name | 2-cyclopentyl-4-cyclopropyl-1,3-thiazol-5-amine |
|---|---|
| PubChem CID | 62077032 |
| Molecular Formula | C11H16N2S |
| Molecular Weight | 208.33 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 2-cyclopentyl-4-cyclopropyl-1,3-thiazol-5-amine |
| SMILES | Nc1sc(C2CCCC2)nc1C1CC1 |
| InChI | InChI=1S/C11H16N2S/c12-10-9(7-5-6-7)13-11(14-10)8-3-1-2-4-8/h7-8H,1-6,12H2 |
| InChIKey | JHMOZIXLPXZUMF-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.33 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |