C9H12N2O2S — CID 83703476
5-amino-2-cyclopentyl-1,3-thiazole-4-carboxylic acid (PubChem CID 83703476) has the molecular formula C9H12N2O2S and a molecular weight of 212.27 g/mol. Its IUPAC name is 5-amino-2-cyclopentyl-1,3-thiazole-4-carboxylic acid.
| Compound Name | 5-amino-2-cyclopentyl-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 83703476 |
| Molecular Formula | C9H12N2O2S |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | 5-amino-2-cyclopentyl-1,3-thiazole-4-carboxylic acid |
| SMILES | Nc1sc(C2CCCC2)nc1C(=O)O |
| InChI | InChI=1S/C9H12N2O2S/c10-7-6(9(12)13)11-8(14-7)5-3-1-2-4-5/h5H,1-4,10H2,(H,12,13) |
| InChIKey | CYNDPJJRJJNQIX-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |