C9H14N4S — CID 117105573
6-(thian-3-yl)pyridazine-3,4-diamine (PubChem CID 117105573) has the molecular formula C9H14N4S and a molecular weight of 210.31 g/mol. Its IUPAC name is 6-(thian-3-yl)pyridazine-3,4-diamine.
| Compound Name | 6-(thian-3-yl)pyridazine-3,4-diamine |
|---|---|
| PubChem CID | 117105573 |
| Molecular Formula | C9H14N4S |
| Molecular Weight | 210.31 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 6-(thian-3-yl)pyridazine-3,4-diamine |
| SMILES | Nc1cc(C2CCCSC2)nnc1N |
| InChI | InChI=1S/C9H14N4S/c10-7-4-8(12-13-9(7)11)6-2-1-3-14-5-6/h4,6H,1-3,5H2,(H2,10,12)(H2,11,13) |
| InChIKey | QNMZEQUYVGWSGF-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.31 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |