C11H19N5 — CID 117105899
6-(1-ethylpiperidin-2-yl)pyridazine-3,4-diamine (PubChem CID 117105899) has the molecular formula C11H19N5 and a molecular weight of 221.31 g/mol. Its IUPAC name is 6-(1-ethylpiperidin-2-yl)pyridazine-3,4-diamine.
| Compound Name | 6-(1-ethylpiperidin-2-yl)pyridazine-3,4-diamine |
|---|---|
| PubChem CID | 117105899 |
| Molecular Formula | C11H19N5 |
| Molecular Weight | 221.31 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | 6-(1-ethylpiperidin-2-yl)pyridazine-3,4-diamine |
| SMILES | CCN1CCCCC1c1cc(N)c(N)nn1 |
| InChI | InChI=1S/C11H19N5/c1-2-16-6-4-3-5-10(16)9-7-8(12)11(13)15-14-9/h7,10H,2-6H2,1H3,(H2,12,14)(H2,13,15) |
| InChIKey | LIMVJQDQJNWFFM-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.31 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |