C11H19N5 — CID 117106143
6-[(1-methylpiperidin-2-yl)methyl]pyridazine-3,4-diamine (PubChem CID 117106143) has the molecular formula C11H19N5 and a molecular weight of 221.31 g/mol. Its IUPAC name is 6-[(1-methylpiperidin-2-yl)methyl]pyridazine-3,4-diamine.
| Compound Name | 6-[(1-methylpiperidin-2-yl)methyl]pyridazine-3,4-diamine |
|---|---|
| PubChem CID | 117106143 |
| Molecular Formula | C11H19N5 |
| Molecular Weight | 221.31 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | 6-[(1-methylpiperidin-2-yl)methyl]pyridazine-3,4-diamine |
| SMILES | CN1CCCCC1Cc1cc(N)c(N)nn1 |
| InChI | InChI=1S/C11H19N5/c1-16-5-3-2-4-9(16)6-8-7-10(12)11(13)15-14-8/h7,9H,2-6H2,1H3,(H2,12,14)(H2,13,15) |
| InChIKey | MGKXPWYAIRPRDE-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.31 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |