C10H14N2O3 — CID 105463948
methyl 5-amino-4-cyclopentyl-1,2-oxazole-3-carboxylate (PubChem CID 105463948) has the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. Its IUPAC name is methyl 5-amino-4-cyclopentyl-1,2-oxazole-3-carboxylate.
| Compound Name | methyl 5-amino-4-cyclopentyl-1,2-oxazole-3-carboxylate |
|---|---|
| PubChem CID | 105463948 |
| Molecular Formula | C10H14N2O3 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | methyl 5-amino-4-cyclopentyl-1,2-oxazole-3-carboxylate |
| SMILES | COC(=O)c1noc(N)c1C1CCCC1 |
| InChI | InChI=1S/C10H14N2O3/c1-14-10(13)8-7(9(11)15-12-8)6-4-2-3-5-6/h6H,2-5,11H2,1H3 |
| InChIKey | MOZXZHIBDBOWRV-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |