C11H15NO3 — CID 154791565
methyl 5-cyclohexyl-1,2-oxazole-3-carboxylate (PubChem CID 154791565) has the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. Its IUPAC name is methyl 5-cyclohexyl-1,2-oxazole-3-carboxylate.
| Compound Name | methyl 5-cyclohexyl-1,2-oxazole-3-carboxylate |
|---|---|
| PubChem CID | 154791565 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | methyl 5-cyclohexyl-1,2-oxazole-3-carboxylate |
| SMILES | COC(=O)c1cc(C2CCCCC2)on1 |
| InChI | InChI=1S/C11H15NO3/c1-14-11(13)9-7-10(15-12-9)8-5-3-2-4-6-8/h7-8H,2-6H2,1H3 |
| InChIKey | ZWFUVRZRUUOXEK-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |