C11H16N2O3 — CID 118728308
(5-cyclopentyl-1,2-oxazol-3-yl) N,N-dimethylcarbamate (PubChem CID 118728308) has the molecular formula C11H16N2O3 and a molecular weight of 224.26 g/mol. Its IUPAC name is (5-cyclopentyl-1,2-oxazol-3-yl) N,N-dimethylcarbamate.
| Compound Name | (5-cyclopentyl-1,2-oxazol-3-yl) N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 118728308 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | (5-cyclopentyl-1,2-oxazol-3-yl) N,N-dimethylcarbamate |
| SMILES | CN(C)C(=O)Oc1cc(C2CCCC2)on1 |
| InChI | InChI=1S/C11H16N2O3/c1-13(2)11(14)15-10-7-9(16-12-10)8-5-3-4-6-8/h7-8H,3-6H2,1-2H3 |
| InChIKey | LCTKLBIKLDIDCL-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |