C8H10N2O4S — CID 154774184
5-cyclopropyl-N-methylsulfonyl-1,2-oxazole-3-carboxamide (PubChem CID 154774184) has the molecular formula C8H10N2O4S and a molecular weight of 230.24 g/mol. Its IUPAC name is 5-cyclopropyl-N-methylsulfonyl-1,2-oxazole-3-carboxamide.
| Compound Name | 5-cyclopropyl-N-methylsulfonyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 154774184 |
| Molecular Formula | C8H10N2O4S |
| Molecular Weight | 230.24 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | 5-cyclopropyl-N-methylsulfonyl-1,2-oxazole-3-carboxamide |
| SMILES | CS(=O)(=O)NC(=O)c1cc(C2CC2)on1 |
| InChI | InChI=1S/C8H10N2O4S/c1-15(12,13)10-8(11)6-4-7(14-9-6)5-2-3-5/h4-5H,2-3H2,1H3,(H,10,11) |
| InChIKey | LNEDLYVLLHRBIG-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.24 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |