2-[(5-cyclopropyl-1,2-oxazole-3-carbonyl)amino]butanoic acid

C11H14N2O4 — CID 43469491

IUPAC2-[(5-cyclopropyl-1,2-oxazole-3-carbonyl)amino]butanoic acid
SMILESCCC(NC(=O)c1cc(C2CC2)on1)C(=O)O
InChIInChI=1S/C11H14N2O4/c1-2-7(11(15)16)12-10(14)8-5-9(17-13-8)6-3-4-6/h5-7H,2-4H2,1H3,(H,12,14)(H,15,16)
InChIKeyCUCFLMWABFIRQZ-UHFFFAOYSA-N
MW238.24 g/mol
LogP1.14
Rot. Bonds5

About 2-[(5-cyclopropyl-1,2-oxazole-3-carbonyl)amino]butanoic acid

2-[(5-cyclopropyl-1,2-oxazole-3-carbonyl)amino]butanoic acid (PubChem CID 43469491) has the molecular formula C11H14N2O4 and a molecular weight of 238.24 g/mol. Its IUPAC name is 2-[(5-cyclopropyl-1,2-oxazole-3-carbonyl)amino]butanoic acid.

Molecular Properties

Compound Name2-[(5-cyclopropyl-1,2-oxazole-3-carbonyl)amino]butanoic acid
PubChem CID43469491
Molecular FormulaC11H14N2O4
Molecular Weight238.24 g/mol
Exact Mass238.10
IUPAC Name2-[(5-cyclopropyl-1,2-oxazole-3-carbonyl)amino]butanoic acid
SMILESCCC(NC(=O)c1cc(C2CC2)on1)C(=O)O
InChIInChI=1S/C11H14N2O4/c1-2-7(11(15)16)12-10(14)8-5-9(17-13-8)6-3-4-6/h5-7H,2-4H2,1H3,(H,12,14)(H,15,16)
InChIKeyCUCFLMWABFIRQZ-UHFFFAOYSA-N
XLogP1.14
TPSA92.43 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500238.24
LogP ≤ 51.14
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-[(5-cyclopropyl-1,2-oxazole-3-carbonyl)amino]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(5-cyclopropyl-1,2-oxazole-3-carbonyl)amino]butanoic acid?
The IUPAC name of 2-[(5-cyclopropyl-1,2-oxazole-3-carbonyl)amino]butanoic acid (CID 43469491) is 2-[(5-cyclopropyl-1,2-oxazole-3-carbonyl)amino]butanoic acid.
What is the SMILES notation for 2-[(5-cyclopropyl-1,2-oxazole-3-carbonyl)amino]butanoic acid?
The canonical SMILES for 2-[(5-cyclopropyl-1,2-oxazole-3-carbonyl)amino]butanoic acid is CCC(NC(=O)c1cc(C2CC2)on1)C(=O)O.
What is the InChIKey of 2-[(5-cyclopropyl-1,2-oxazole-3-carbonyl)amino]butanoic acid?
The InChIKey is CUCFLMWABFIRQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O4/c1-2-7(11(15)16)12-10(14)8-5-9(17-13-8)6-3-4-6/h5-7H,2-4H2,1H3,(H,12,14)(H,15,16).
What are the key properties of 2-[(5-cyclopropyl-1,2-oxazole-3-carbonyl)amino]butanoic acid?
2-[(5-cyclopropyl-1,2-oxazole-3-carbonyl)amino]butanoic acid has a molecular weight of 238.24 g/mol, XLogP of 1.14, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-cyclopropyl-1,2-oxazole-3-carbonyl)amino]butanoic acid is sourced from PubChem (CID 43469491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).