C13H14N2O6 — CID 12996644
dimethyl (1R,8S)-12,13-dioxa-4,5-diazatricyclo[6.3.2.02,7]trideca-2(7),3,5-triene-3,6-dicarboxylate (PubChem CID 12996644) has the molecular formula C13H14N2O6 and a molecular weight of 294.26 g/mol. Its IUPAC name is dimethyl (1R,8S)-12,13-dioxa-4,5-diazatricyclo[6.3.2.02,7]trideca-2(7),3,5-triene-3,6-dicarboxylate.
| Compound Name | dimethyl (1R,8S)-12,13-dioxa-4,5-diazatricyclo[6.3.2.02,7]trideca-2(7),3,5-triene-3,6-dicarboxylate |
|---|---|
| PubChem CID | 12996644 |
| Molecular Formula | C13H14N2O6 |
| Molecular Weight | 294.26 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | dimethyl (1R,8S)-12,13-dioxa-4,5-diazatricyclo[6.3.2.02,7]trideca-2(7),3,5-triene-3,6-dicarboxylate |
| SMILES | COC(=O)c1nnc(C(=O)OC)c2c1[C@@H]1CCC[C@H]2OO1 |
| InChI | InChI=1S/C13H14N2O6/c1-18-12(16)10-8-6-4-3-5-7(21-20-6)9(8)11(15-14-10)13(17)19-2/h6-7H,3-5H2,1-2H3/t6-,7+ |
| InChIKey | KSFSHWNZZGHCRU-KNVOCYPGSA-N |
| XLogP | 1.28 |
| TPSA | 96.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.26 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|