C10H13NO4 — CID 105464783
4-cyclopentyl-5-methoxy-1,2-oxazole-3-carboxylic acid (PubChem CID 105464783) has the molecular formula C10H13NO4 and a molecular weight of 211.22 g/mol. Its IUPAC name is 4-cyclopentyl-5-methoxy-1,2-oxazole-3-carboxylic acid.
| Compound Name | 4-cyclopentyl-5-methoxy-1,2-oxazole-3-carboxylic acid |
|---|---|
| PubChem CID | 105464783 |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 4-cyclopentyl-5-methoxy-1,2-oxazole-3-carboxylic acid |
| SMILES | COc1onc(C(=O)O)c1C1CCCC1 |
| InChI | InChI=1S/C10H13NO4/c1-14-10-7(6-4-2-3-5-6)8(9(12)13)11-15-10/h6H,2-5H2,1H3,(H,12,13) |
| InChIKey | VJOHDWIOAKTTTD-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |