C8H6FNOS — CID 123369896
5-fluoro-3-methylsulfanyl-1,2-benzoxazole (PubChem CID 123369896) has the molecular formula C8H6FNOS and a molecular weight of 183.21 g/mol. Its IUPAC name is 5-fluoro-3-methylsulfanyl-1,2-benzoxazole.
| Compound Name | 5-fluoro-3-methylsulfanyl-1,2-benzoxazole |
|---|---|
| PubChem CID | 123369896 |
| Molecular Formula | C8H6FNOS |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.02 |
| IUPAC Name | 5-fluoro-3-methylsulfanyl-1,2-benzoxazole |
| SMILES | CSc1noc2ccc(F)cc12 |
| InChI | InChI=1S/C8H6FNOS/c1-12-8-6-4-5(9)2-3-7(6)11-10-8/h2-4H,1H3 |
| InChIKey | LSFXEIITSCPADU-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |