C12H12F3N3 — CID 82571181
N'-(5,6,7-trifluoroisoquinolin-1-yl)propane-1,3-diamine (PubChem CID 82571181) has the molecular formula C12H12F3N3 and a molecular weight of 255.24 g/mol. Its IUPAC name is N'-(5,6,7-trifluoroisoquinolin-1-yl)propane-1,3-diamine.
| Compound Name | N'-(5,6,7-trifluoroisoquinolin-1-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 82571181 |
| Molecular Formula | C12H12F3N3 |
| Molecular Weight | 255.24 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | N'-(5,6,7-trifluoroisoquinolin-1-yl)propane-1,3-diamine |
| SMILES | NCCCNc1nccc2c(F)c(F)c(F)cc12 |
| InChI | InChI=1S/C12H12F3N3/c13-9-6-8-7(10(14)11(9)15)2-5-18-12(8)17-4-1-3-16/h2,5-6H,1,3-4,16H2,(H,17,18) |
| InChIKey | AAKUBYBAQCQKNG-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.24 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|