C16H23N3 — CID 82571189
N'-(7-butylisoquinolin-1-yl)propane-1,3-diamine (PubChem CID 82571189) has the molecular formula C16H23N3 and a molecular weight of 257.38 g/mol. Its IUPAC name is N'-(7-butylisoquinolin-1-yl)propane-1,3-diamine.
| Compound Name | N'-(7-butylisoquinolin-1-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 82571189 |
| Molecular Formula | C16H23N3 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.19 |
| IUPAC Name | N'-(7-butylisoquinolin-1-yl)propane-1,3-diamine |
| SMILES | CCCCc1ccc2ccnc(NCCCN)c2c1 |
| InChI | InChI=1S/C16H23N3/c1-2-3-5-13-6-7-14-8-11-19-16(15(14)12-13)18-10-4-9-17/h6-8,11-12H,2-5,9-10,17H2,1H3,(H,18,19) |
| InChIKey | PJCNHFFWRZRUBP-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|