C13H18N4 — CID 82570383
1-N-(3-aminopropyl)-7-methylisoquinoline-1,5-diamine (PubChem CID 82570383) has the molecular formula C13H18N4 and a molecular weight of 230.31 g/mol. Its IUPAC name is 1-N-(3-aminopropyl)-7-methylisoquinoline-1,5-diamine.
| Compound Name | 1-N-(3-aminopropyl)-7-methylisoquinoline-1,5-diamine |
|---|---|
| PubChem CID | 82570383 |
| Molecular Formula | C13H18N4 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 1-N-(3-aminopropyl)-7-methylisoquinoline-1,5-diamine |
| SMILES | Cc1cc(N)c2ccnc(NCCCN)c2c1 |
| InChI | InChI=1S/C13H18N4/c1-9-7-11-10(12(15)8-9)3-6-17-13(11)16-5-2-4-14/h3,6-8H,2,4-5,14-15H2,1H3,(H,16,17) |
| InChIKey | DMXSHIGYBOHQQF-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|