C14H17N3O2 — CID 82570362
4-[(5-amino-7-methylisoquinolin-1-yl)amino]butanoic acid (PubChem CID 82570362) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is 4-[(5-amino-7-methylisoquinolin-1-yl)amino]butanoic acid.
| Compound Name | 4-[(5-amino-7-methylisoquinolin-1-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 82570362 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | 4-[(5-amino-7-methylisoquinolin-1-yl)amino]butanoic acid |
| SMILES | Cc1cc(N)c2ccnc(NCCCC(=O)O)c2c1 |
| InChI | InChI=1S/C14H17N3O2/c1-9-7-11-10(12(15)8-9)4-6-17-14(11)16-5-2-3-13(18)19/h4,6-8H,2-3,5,15H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | VKNSKUMYZIVLGT-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|