C11H10F3N3 — CID 82571180
N'-(5,6,7-trifluoroisoquinolin-1-yl)ethane-1,2-diamine (PubChem CID 82571180) has the molecular formula C11H10F3N3 and a molecular weight of 241.22 g/mol. Its IUPAC name is N'-(5,6,7-trifluoroisoquinolin-1-yl)ethane-1,2-diamine.
| Compound Name | N'-(5,6,7-trifluoroisoquinolin-1-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 82571180 |
| Molecular Formula | C11H10F3N3 |
| Molecular Weight | 241.22 g/mol |
| Exact Mass | 241.08 |
| IUPAC Name | N'-(5,6,7-trifluoroisoquinolin-1-yl)ethane-1,2-diamine |
| SMILES | NCCNc1nccc2c(F)c(F)c(F)cc12 |
| InChI | InChI=1S/C11H10F3N3/c12-8-5-7-6(9(13)10(8)14)1-3-16-11(7)17-4-2-15/h1,3,5H,2,4,15H2,(H,16,17) |
| InChIKey | DBZCLMRJHUQFBR-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.22 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|