C10H5F3N2O2 — CID 82574360
5,6,7-trifluoro-N-hydroxyisoquinoline-1-carboxamide (PubChem CID 82574360) has the molecular formula C10H5F3N2O2 and a molecular weight of 242.16 g/mol. Its IUPAC name is 5,6,7-trifluoro-N-hydroxyisoquinoline-1-carboxamide.
| Compound Name | 5,6,7-trifluoro-N-hydroxyisoquinoline-1-carboxamide |
|---|---|
| PubChem CID | 82574360 |
| Molecular Formula | C10H5F3N2O2 |
| Molecular Weight | 242.16 g/mol |
| Exact Mass | 242.03 |
| IUPAC Name | 5,6,7-trifluoro-N-hydroxyisoquinoline-1-carboxamide |
| SMILES | O=C(NO)c1nccc2c(F)c(F)c(F)cc12 |
| InChI | InChI=1S/C10H5F3N2O2/c11-6-3-5-4(7(12)8(6)13)1-2-14-9(5)10(16)15-17/h1-3,17H,(H,15,16) |
| InChIKey | JVGWVBUIRPLWSX-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.16 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|