C11H6F3NO — CID 82576140
1-(5,6,7-trifluoroisoquinolin-1-yl)ethanone (PubChem CID 82576140) has the molecular formula C11H6F3NO and a molecular weight of 225.17 g/mol. Its IUPAC name is 1-(5,6,7-trifluoroisoquinolin-1-yl)ethanone.
| Compound Name | 1-(5,6,7-trifluoroisoquinolin-1-yl)ethanone |
|---|---|
| PubChem CID | 82576140 |
| Molecular Formula | C11H6F3NO |
| Molecular Weight | 225.17 g/mol |
| Exact Mass | 225.04 |
| IUPAC Name | 1-(5,6,7-trifluoroisoquinolin-1-yl)ethanone |
| SMILES | CC(=O)c1nccc2c(F)c(F)c(F)cc12 |
| InChI | InChI=1S/C11H6F3NO/c1-5(16)11-7-4-8(12)10(14)9(13)6(7)2-3-15-11/h2-4H,1H3 |
| InChIKey | VPPSYMGJYWGKKU-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.17 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|