C10H11NO4 — CID 58914368
(2-acetyl-4-methoxy-3-pyridinyl) acetate (PubChem CID 58914368) has the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. Its IUPAC name is (2-acetyl-4-methoxy-3-pyridinyl) acetate.
| Compound Name | (2-acetyl-4-methoxy-3-pyridinyl) acetate |
|---|---|
| PubChem CID | 58914368 |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.20 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | (2-acetyl-4-methoxy-3-pyridinyl) acetate |
| SMILES | COc1ccnc(C(C)=O)c1OC(C)=O |
| InChI | InChI=1S/C10H11NO4/c1-6(12)9-10(15-7(2)13)8(14-3)4-5-11-9/h4-5H,1-3H3 |
| InChIKey | YNXIDANDGAJZJL-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.20 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |