C19H27NO7 — CID 147944029
[(2S)-1-propoxypropan-2-yl] (2R)-4-(3-acetyloxy-4-methoxy-2-pyridinyl)-2-methyl-4-oxobutanoate (PubChem CID 147944029) has the molecular formula C19H27NO7 and a molecular weight of 381.43 g/mol. Its IUPAC name is [(2S)-1-propoxypropan-2-yl] (2R)-4-(3-acetyloxy-4-methoxy-2-pyridinyl)-2-methyl-4-oxobutanoate.
| Compound Name | [(2S)-1-propoxypropan-2-yl] (2R)-4-(3-acetyloxy-4-methoxy-2-pyridinyl)-2-methyl-4-oxobutanoate |
|---|---|
| PubChem CID | 147944029 |
| Molecular Formula | C19H27NO7 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | [(2S)-1-propoxypropan-2-yl] (2R)-4-(3-acetyloxy-4-methoxy-2-pyridinyl)-2-methyl-4-oxobutanoate |
| SMILES | CCCOC[C@H](C)OC(=O)[C@H](C)CC(=O)c1nccc(OC)c1OC(C)=O |
| InChI | InChI=1S/C19H27NO7/c1-6-9-25-11-13(3)26-19(23)12(2)10-15(22)17-18(27-14(4)21)16(24-5)7-8-20-17/h7-8,12-13H,6,9-11H2,1-5H3/t12-,13+/m1/s1 |
| InChIKey | IMHWBDUYMFLINP-OLZOCXBDSA-N |
| XLogP | 2.58 |
| TPSA | 101.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|