C24H29NO8 — CID 162254495
[(2S)-1-phenylmethoxypropan-2-yl] (2R)-4-[3-(acetyloxymethoxy)-4-methoxy-2-pyridinyl]-2-methyl-4-oxobutanoate (PubChem CID 162254495) has the molecular formula C24H29NO8 and a molecular weight of 459.50 g/mol. Its IUPAC name is [(2S)-1-phenylmethoxypropan-2-yl] (2R)-4-[3-(acetyloxymethoxy)-4-methoxy-2-pyridinyl]-2-methyl-4-oxobutanoate.
| Compound Name | [(2S)-1-phenylmethoxypropan-2-yl] (2R)-4-[3-(acetyloxymethoxy)-4-methoxy-2-pyridinyl]-2-methyl-4-oxobutanoate |
|---|---|
| PubChem CID | 162254495 |
| Molecular Formula | C24H29NO8 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | [(2S)-1-phenylmethoxypropan-2-yl] (2R)-4-[3-(acetyloxymethoxy)-4-methoxy-2-pyridinyl]-2-methyl-4-oxobutanoate |
| SMILES | COc1ccnc(C(=O)C[C@@H](C)C(=O)O[C@@H](C)COCc2ccccc2)c1OCOC(C)=O |
| InChI | InChI=1S/C24H29NO8/c1-16(24(28)33-17(2)13-30-14-19-8-6-5-7-9-19)12-20(27)22-23(32-15-31-18(3)26)21(29-4)10-11-25-22/h5-11,16-17H,12-15H2,1-4H3/t16-,17+/m1/s1 |
| InChIKey | ZYKLSZDAJWSXRO-SJORKVTESA-N |
| XLogP | 3.35 |
| TPSA | 110.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|