C25H29NO8 — CID 147310285
[(3S,4S)-4-phenoxypent-1-en-3-yl] (2R)-4-[3-(acetyloxymethoxy)-4-methoxy-2-pyridinyl]-2-methyl-4-oxobutanoate (PubChem CID 147310285) has the molecular formula C25H29NO8 and a molecular weight of 471.51 g/mol. Its IUPAC name is [(3S,4S)-4-phenoxypent-1-en-3-yl] (2R)-4-[3-(acetyloxymethoxy)-4-methoxy-2-pyridinyl]-2-methyl-4-oxobutanoate.
| Compound Name | [(3S,4S)-4-phenoxypent-1-en-3-yl] (2R)-4-[3-(acetyloxymethoxy)-4-methoxy-2-pyridinyl]-2-methyl-4-oxobutanoate |
|---|---|
| PubChem CID | 147310285 |
| Molecular Formula | C25H29NO8 |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | [(3S,4S)-4-phenoxypent-1-en-3-yl] (2R)-4-[3-(acetyloxymethoxy)-4-methoxy-2-pyridinyl]-2-methyl-4-oxobutanoate |
| SMILES | C=C[C@H](OC(=O)[C@H](C)CC(=O)c1nccc(OC)c1OCOC(C)=O)[C@H](C)Oc1ccccc1 |
| InChI | InChI=1S/C25H29NO8/c1-6-21(17(3)33-19-10-8-7-9-11-19)34-25(29)16(2)14-20(28)23-24(32-15-31-18(4)27)22(30-5)12-13-26-23/h6-13,16-17,21H,1,14-15H2,2-5H3/t16-,17+,21+/m1/s1 |
| InChIKey | CXUZENGBLDCBRU-WWMYMODYSA-N |
| XLogP | 3.76 |
| TPSA | 110.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|