C25H29NO6S — CID 147445232
[(2S,3R)-3-phenoxyhex-5-en-2-yl] (2R)-4-(3-acetyloxy-4-methoxy-2-pyridinyl)-2-methyl-4-sulfanylidenebutanoate (PubChem CID 147445232) has the molecular formula C25H29NO6S and a molecular weight of 471.58 g/mol. Its IUPAC name is [(2S,3R)-3-phenoxyhex-5-en-2-yl] (2R)-4-(3-acetyloxy-4-methoxy-2-pyridinyl)-2-methyl-4-sulfanylidenebutanoate.
| Compound Name | [(2S,3R)-3-phenoxyhex-5-en-2-yl] (2R)-4-(3-acetyloxy-4-methoxy-2-pyridinyl)-2-methyl-4-sulfanylidenebutanoate |
|---|---|
| PubChem CID | 147445232 |
| Molecular Formula | C25H29NO6S |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | [(2S,3R)-3-phenoxyhex-5-en-2-yl] (2R)-4-(3-acetyloxy-4-methoxy-2-pyridinyl)-2-methyl-4-sulfanylidenebutanoate |
| SMILES | C=CC[C@@H](Oc1ccccc1)[C@H](C)OC(=O)[C@H](C)CC(=S)c1nccc(OC)c1OC(C)=O |
| InChI | InChI=1S/C25H29NO6S/c1-6-10-20(32-19-11-8-7-9-12-19)17(3)30-25(28)16(2)15-22(33)23-24(31-18(4)27)21(29-5)13-14-26-23/h6-9,11-14,16-17,20H,1,10,15H2,2-5H3/t16-,17+,20-/m1/s1 |
| InChIKey | DWZMBMXQOHROAH-FUHIMQAGSA-N |
| XLogP | 4.72 |
| TPSA | 83.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|