C30H31F2NO7S — CID 158225469
[(2S)-1,1-bis(2-fluoro-4-methoxyphenyl)propan-2-yl] (2R)-4-(3-acetyloxy-4-methoxy-2-pyridinyl)-2-methyl-4-sulfanylidenebutanoate (PubChem CID 158225469) has the molecular formula C30H31F2NO7S and a molecular weight of 587.64 g/mol. Its IUPAC name is [(2S)-1,1-bis(2-fluoro-4-methoxyphenyl)propan-2-yl] (2R)-4-(3-acetyloxy-4-methoxy-2-pyridinyl)-2-methyl-4-sulfanylidenebutanoate.
| Compound Name | [(2S)-1,1-bis(2-fluoro-4-methoxyphenyl)propan-2-yl] (2R)-4-(3-acetyloxy-4-methoxy-2-pyridinyl)-2-methyl-4-sulfanylidenebutanoate |
|---|---|
| PubChem CID | 158225469 |
| Molecular Formula | C30H31F2NO7S |
| Molecular Weight | 587.64 g/mol |
| Exact Mass | 587.18 |
| IUPAC Name | [(2S)-1,1-bis(2-fluoro-4-methoxyphenyl)propan-2-yl] (2R)-4-(3-acetyloxy-4-methoxy-2-pyridinyl)-2-methyl-4-sulfanylidenebutanoate |
| SMILES | COc1ccc(C(c2ccc(OC)cc2F)[C@H](C)OC(=O)[C@H](C)CC(=S)c2nccc(OC)c2OC(C)=O)c(F)c1 |
| InChI | InChI=1S/C30H31F2NO7S/c1-16(13-26(41)28-29(40-18(3)34)25(38-6)11-12-33-28)30(35)39-17(2)27(21-9-7-19(36-4)14-23(21)31)22-10-8-20(37-5)15-24(22)32/h7-12,14-17,27H,13H2,1-6H3/t16-,17+/m1/s1 |
| InChIKey | GDSZHVVIRCNHEJ-SJORKVTESA-N |
| XLogP | 5.82 |
| TPSA | 93.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.64 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|