C26H33NO6S — CID 152789231
[(2S,3R)-3-(4-methylphenoxy)hexan-2-yl] (2R)-4-(3-acetyloxy-4-methoxy-2-pyridinyl)-2-methyl-4-sulfanylidenebutanoate (PubChem CID 152789231) has the molecular formula C26H33NO6S and a molecular weight of 487.62 g/mol. Its IUPAC name is [(2S,3R)-3-(4-methylphenoxy)hexan-2-yl] (2R)-4-(3-acetyloxy-4-methoxy-2-pyridinyl)-2-methyl-4-sulfanylidenebutanoate.
| Compound Name | [(2S,3R)-3-(4-methylphenoxy)hexan-2-yl] (2R)-4-(3-acetyloxy-4-methoxy-2-pyridinyl)-2-methyl-4-sulfanylidenebutanoate |
|---|---|
| PubChem CID | 152789231 |
| Molecular Formula | C26H33NO6S |
| Molecular Weight | 487.62 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | [(2S,3R)-3-(4-methylphenoxy)hexan-2-yl] (2R)-4-(3-acetyloxy-4-methoxy-2-pyridinyl)-2-methyl-4-sulfanylidenebutanoate |
| SMILES | CCC[C@@H](Oc1ccc(C)cc1)[C@H](C)OC(=O)[C@H](C)CC(=S)c1nccc(OC)c1OC(C)=O |
| InChI | InChI=1S/C26H33NO6S/c1-7-8-21(33-20-11-9-16(2)10-12-20)18(4)31-26(29)17(3)15-23(34)24-25(32-19(5)28)22(30-6)13-14-27-24/h9-14,17-18,21H,7-8,15H2,1-6H3/t17-,18+,21-/m1/s1 |
| InChIKey | SEBHKHFCHMKIPW-LVCYWYKZSA-N |
| XLogP | 5.25 |
| TPSA | 83.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.62 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|