C24H31NO5S — CID 159935266
[(2S,3R)-3-(4-methylphenoxy)hexan-2-yl] (2R)-4-(3-hydroxy-4-methoxy-2-pyridinyl)-2-methyl-4-sulfanylidenebutanoate (PubChem CID 159935266) has the molecular formula C24H31NO5S and a molecular weight of 445.58 g/mol. Its IUPAC name is [(2S,3R)-3-(4-methylphenoxy)hexan-2-yl] (2R)-4-(3-hydroxy-4-methoxy-2-pyridinyl)-2-methyl-4-sulfanylidenebutanoate.
| Compound Name | [(2S,3R)-3-(4-methylphenoxy)hexan-2-yl] (2R)-4-(3-hydroxy-4-methoxy-2-pyridinyl)-2-methyl-4-sulfanylidenebutanoate |
|---|---|
| PubChem CID | 159935266 |
| Molecular Formula | C24H31NO5S |
| Molecular Weight | 445.58 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | [(2S,3R)-3-(4-methylphenoxy)hexan-2-yl] (2R)-4-(3-hydroxy-4-methoxy-2-pyridinyl)-2-methyl-4-sulfanylidenebutanoate |
| SMILES | CCC[C@@H](Oc1ccc(C)cc1)[C@H](C)OC(=O)[C@H](C)CC(=S)c1nccc(OC)c1O |
| InChI | InChI=1S/C24H31NO5S/c1-6-7-19(30-18-10-8-15(2)9-11-18)17(4)29-24(27)16(3)14-21(31)22-23(26)20(28-5)12-13-25-22/h8-13,16-17,19,26H,6-7,14H2,1-5H3/t16-,17+,19-/m1/s1 |
| InChIKey | OADZONXODLENMH-ZIFCJYIRSA-N |
| XLogP | 5.03 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.58 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|