C22H30N2O5S — CID 142299007
2-(4-methylphenoxy)propyl 2-[(3-hydroxy-4-methoxypyridine-2-carbothioyl)amino]acetate;propane (PubChem CID 142299007) has the molecular formula C22H30N2O5S and a molecular weight of 434.56 g/mol. Its IUPAC name is 2-(4-methylphenoxy)propyl 2-[(3-hydroxy-4-methoxypyridine-2-carbothioyl)amino]acetate;propane.
| Compound Name | 2-(4-methylphenoxy)propyl 2-[(3-hydroxy-4-methoxypyridine-2-carbothioyl)amino]acetate;propane |
|---|---|
| PubChem CID | 142299007 |
| Molecular Formula | C22H30N2O5S |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | 2-(4-methylphenoxy)propyl 2-[(3-hydroxy-4-methoxypyridine-2-carbothioyl)amino]acetate;propane |
| SMILES | CCC.COc1ccnc(C(=S)NCC(=O)OCC(C)Oc2ccc(C)cc2)c1O |
| InChI | InChI=1S/C19H22N2O5S.C3H8/c1-12-4-6-14(7-5-12)26-13(2)11-25-16(22)10-21-19(27)17-18(23)15(24-3)8-9-20-17;1-3-2/h4-9,13,23H,10-11H2,1-3H3,(H,21,27);3H2,1-2H3 |
| InChIKey | BMRWXJKYDJDEIP-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 89.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|