C20H23NO6 — CID 158940143
[(2S)-2-phenoxypropyl] (2R)-4-(3-hydroxy-4-methoxy-2-pyridinyl)-2-methyl-4-oxobutanoate (PubChem CID 158940143) has the molecular formula C20H23NO6 and a molecular weight of 373.41 g/mol. Its IUPAC name is [(2S)-2-phenoxypropyl] (2R)-4-(3-hydroxy-4-methoxy-2-pyridinyl)-2-methyl-4-oxobutanoate.
| Compound Name | [(2S)-2-phenoxypropyl] (2R)-4-(3-hydroxy-4-methoxy-2-pyridinyl)-2-methyl-4-oxobutanoate |
|---|---|
| PubChem CID | 158940143 |
| Molecular Formula | C20H23NO6 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | [(2S)-2-phenoxypropyl] (2R)-4-(3-hydroxy-4-methoxy-2-pyridinyl)-2-methyl-4-oxobutanoate |
| SMILES | COc1ccnc(C(=O)C[C@@H](C)C(=O)OC[C@H](C)Oc2ccccc2)c1O |
| InChI | InChI=1S/C20H23NO6/c1-13(11-16(22)18-19(23)17(25-3)9-10-21-18)20(24)26-12-14(2)27-15-7-5-4-6-8-15/h4-10,13-14,23H,11-12H2,1-3H3/t13-,14+/m1/s1 |
| InChIKey | JKDJULAZFUMZBK-KGLIPLIRSA-N |
| XLogP | 3.02 |
| TPSA | 94.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |