C18H20N2O5S — CID 142298933
[(2S)-2-phenoxypropyl] 2-[(3-hydroxy-4-methoxypyridine-2-carbothioyl)amino]acetate (PubChem CID 142298933) has the molecular formula C18H20N2O5S and a molecular weight of 376.43 g/mol. Its IUPAC name is [(2S)-2-phenoxypropyl] 2-[(3-hydroxy-4-methoxypyridine-2-carbothioyl)amino]acetate.
| Compound Name | [(2S)-2-phenoxypropyl] 2-[(3-hydroxy-4-methoxypyridine-2-carbothioyl)amino]acetate |
|---|---|
| PubChem CID | 142298933 |
| Molecular Formula | C18H20N2O5S |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | [(2S)-2-phenoxypropyl] 2-[(3-hydroxy-4-methoxypyridine-2-carbothioyl)amino]acetate |
| SMILES | COc1ccnc(C(=S)NCC(=O)OC[C@H](C)Oc2ccccc2)c1O |
| InChI | InChI=1S/C18H20N2O5S/c1-12(25-13-6-4-3-5-7-13)11-24-15(21)10-20-18(26)16-17(22)14(23-2)8-9-19-16/h3-9,12,22H,10-11H2,1-2H3,(H,20,26)/t12-/m0/s1 |
| InChIKey | TXRVGXLPDPQFAN-LBPRGKRZSA-N |
| XLogP | 2.07 |
| TPSA | 89.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|