C21H26N2O6 — CID 145115251
4-phenoxyhexan-2-yl 2-[(3-hydroxy-4-methoxypyridine-2-carbonyl)amino]acetate (PubChem CID 145115251) has the molecular formula C21H26N2O6 and a molecular weight of 402.45 g/mol. Its IUPAC name is 4-phenoxyhexan-2-yl 2-[(3-hydroxy-4-methoxypyridine-2-carbonyl)amino]acetate.
| Compound Name | 4-phenoxyhexan-2-yl 2-[(3-hydroxy-4-methoxypyridine-2-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 145115251 |
| Molecular Formula | C21H26N2O6 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 4-phenoxyhexan-2-yl 2-[(3-hydroxy-4-methoxypyridine-2-carbonyl)amino]acetate |
| SMILES | CCC(CC(C)OC(=O)CNC(=O)c1nccc(OC)c1O)Oc1ccccc1 |
| InChI | InChI=1S/C21H26N2O6/c1-4-15(29-16-8-6-5-7-9-16)12-14(2)28-18(24)13-23-21(26)19-20(25)17(27-3)10-11-22-19/h5-11,14-15,25H,4,12-13H2,1-3H3,(H,23,26) |
| InChIKey | GXHJPOFTYICZRH-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 106.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |