C15H22N2O5 — CID 146481386
hexan-2-yl 2-[(3-hydroxy-4-methoxypyridine-2-carbonyl)amino]acetate (PubChem CID 146481386) has the molecular formula C15H22N2O5 and a molecular weight of 310.35 g/mol. Its IUPAC name is hexan-2-yl 2-[(3-hydroxy-4-methoxypyridine-2-carbonyl)amino]acetate.
| Compound Name | hexan-2-yl 2-[(3-hydroxy-4-methoxypyridine-2-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 146481386 |
| Molecular Formula | C15H22N2O5 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | hexan-2-yl 2-[(3-hydroxy-4-methoxypyridine-2-carbonyl)amino]acetate |
| SMILES | CCCCC(C)OC(=O)CNC(=O)c1nccc(OC)c1O |
| InChI | InChI=1S/C15H22N2O5/c1-4-5-6-10(2)22-12(18)9-17-15(20)13-14(19)11(21-3)7-8-16-13/h7-8,10,19H,4-6,9H2,1-3H3,(H,17,20) |
| InChIKey | OQVPIKQEEAQHBJ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |