C18H18ClFN2O4S — CID 142298998
1-(2-chloro-4-fluorophenyl)propan-2-yl 2-[(3-hydroxy-4-methoxypyridine-2-carbothioyl)amino]acetate (PubChem CID 142298998) has the molecular formula C18H18ClFN2O4S and a molecular weight of 412.87 g/mol. Its IUPAC name is 1-(2-chloro-4-fluorophenyl)propan-2-yl 2-[(3-hydroxy-4-methoxypyridine-2-carbothioyl)amino]acetate.
| Compound Name | 1-(2-chloro-4-fluorophenyl)propan-2-yl 2-[(3-hydroxy-4-methoxypyridine-2-carbothioyl)amino]acetate |
|---|---|
| PubChem CID | 142298998 |
| Molecular Formula | C18H18ClFN2O4S |
| Molecular Weight | 412.87 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | 1-(2-chloro-4-fluorophenyl)propan-2-yl 2-[(3-hydroxy-4-methoxypyridine-2-carbothioyl)amino]acetate |
| SMILES | COc1ccnc(C(=S)NCC(=O)OC(C)Cc2ccc(F)cc2Cl)c1O |
| InChI | InChI=1S/C18H18ClFN2O4S/c1-10(7-11-3-4-12(20)8-13(11)19)26-15(23)9-22-18(27)16-17(24)14(25-2)5-6-21-16/h3-6,8,10,24H,7,9H2,1-2H3,(H,22,27) |
| InChIKey | LHRPNJZULCFJDA-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.87 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|