C25H36N2O7 — CID 145115516
(2-carbamoyl-4-methoxy-3-pyridinyl) acetate;2-(4-methylphenoxy)propyl propanoate;propane (PubChem CID 145115516) has the molecular formula C25H36N2O7 and a molecular weight of 476.57 g/mol. Its IUPAC name is (2-carbamoyl-4-methoxy-3-pyridinyl) acetate;2-(4-methylphenoxy)propyl propanoate;propane.
| Compound Name | (2-carbamoyl-4-methoxy-3-pyridinyl) acetate;2-(4-methylphenoxy)propyl propanoate;propane |
|---|---|
| PubChem CID | 145115516 |
| Molecular Formula | C25H36N2O7 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.25 |
| IUPAC Name | (2-carbamoyl-4-methoxy-3-pyridinyl) acetate;2-(4-methylphenoxy)propyl propanoate;propane |
| SMILES | CCC.CCC(=O)OCC(C)Oc1ccc(C)cc1.COc1ccnc(C(N)=O)c1OC(C)=O |
| InChI | InChI=1S/C13H18O3.C9H10N2O4.C3H8/c1-4-13(14)15-9-11(3)16-12-7-5-10(2)6-8-12;1-5(12)15-8-6(14-2)3-4-11-7(8)9(10)13;1-3-2/h5-8,11H,4,9H2,1-3H3;3-4H,1-2H3,(H2,10,13);3H2,1-2H3 |
| InChIKey | ZMJFRSSNXYWFRV-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 127.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |