C26H38N2O7 — CID 145115167
4-(cyclopropylmethoxy)butan-2-yl propanoate;3-hydroxy-4-methoxypyridine-2-carboxamide;1-methoxy-4-methylbenzene (PubChem CID 145115167) has the molecular formula C26H38N2O7 and a molecular weight of 490.60 g/mol. Its IUPAC name is 4-(cyclopropylmethoxy)butan-2-yl propanoate;3-hydroxy-4-methoxypyridine-2-carboxamide;1-methoxy-4-methylbenzene.
| Compound Name | 4-(cyclopropylmethoxy)butan-2-yl propanoate;3-hydroxy-4-methoxypyridine-2-carboxamide;1-methoxy-4-methylbenzene |
|---|---|
| PubChem CID | 145115167 |
| Molecular Formula | C26H38N2O7 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.27 |
| IUPAC Name | 4-(cyclopropylmethoxy)butan-2-yl propanoate;3-hydroxy-4-methoxypyridine-2-carboxamide;1-methoxy-4-methylbenzene |
| SMILES | CCC(=O)OC(C)CCOCC1CC1.COc1ccc(C)cc1.COc1ccnc(C(N)=O)c1O |
| InChI | InChI=1S/C11H20O3.C8H10O.C7H8N2O3/c1-3-11(12)14-9(2)6-7-13-8-10-4-5-10;1-7-3-5-8(9-2)6-4-7;1-12-4-2-3-9-5(6(4)10)7(8)11/h9-10H,3-8H2,1-2H3;3-6H,1-2H3;2-3,10H,1H3,(H2,8,11) |
| InChIKey | DEWNYPCMGNLKNO-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 130.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|