C25H36N2O7 — CID 145115422
4-propoxybutan-2-yl 2-[(3-hydroxy-4-methoxypyridine-2-carbonyl)amino]-3-methoxypropanoate;toluene (PubChem CID 145115422) has the molecular formula C25H36N2O7 and a molecular weight of 476.57 g/mol. Its IUPAC name is 4-propoxybutan-2-yl 2-[(3-hydroxy-4-methoxypyridine-2-carbonyl)amino]-3-methoxypropanoate;toluene.
| Compound Name | 4-propoxybutan-2-yl 2-[(3-hydroxy-4-methoxypyridine-2-carbonyl)amino]-3-methoxypropanoate;toluene |
|---|---|
| PubChem CID | 145115422 |
| Molecular Formula | C25H36N2O7 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.25 |
| IUPAC Name | 4-propoxybutan-2-yl 2-[(3-hydroxy-4-methoxypyridine-2-carbonyl)amino]-3-methoxypropanoate;toluene |
| SMILES | CCCOCCC(C)OC(=O)C(COC)NC(=O)c1nccc(OC)c1O.Cc1ccccc1 |
| InChI | InChI=1S/C18H28N2O7.C7H8/c1-5-9-26-10-7-12(2)27-18(23)13(11-24-3)20-17(22)15-16(21)14(25-4)6-8-19-15;1-7-5-3-2-4-6-7/h6,8,12-13,21H,5,7,9-11H2,1-4H3,(H,20,22);2-6H,1H3 |
| InChIKey | RQTISTGOLUROAB-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 116.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|