C24H32N2O5 — CID 123268993
ethyl 6-benzyl-2-[(3-hydroxy-4-methoxypyridine-2-carbonyl)amino]octanoate (PubChem CID 123268993) has the molecular formula C24H32N2O5 and a molecular weight of 428.53 g/mol. Its IUPAC name is ethyl 6-benzyl-2-[(3-hydroxy-4-methoxypyridine-2-carbonyl)amino]octanoate.
| Compound Name | ethyl 6-benzyl-2-[(3-hydroxy-4-methoxypyridine-2-carbonyl)amino]octanoate |
|---|---|
| PubChem CID | 123268993 |
| Molecular Formula | C24H32N2O5 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | ethyl 6-benzyl-2-[(3-hydroxy-4-methoxypyridine-2-carbonyl)amino]octanoate |
| SMILES | CCOC(=O)C(CCCC(CC)Cc1ccccc1)NC(=O)c1nccc(OC)c1O |
| InChI | InChI=1S/C24H32N2O5/c1-4-17(16-18-10-7-6-8-11-18)12-9-13-19(24(29)31-5-2)26-23(28)21-22(27)20(30-3)14-15-25-21/h6-8,10-11,14-15,17,19,27H,4-5,9,12-13,16H2,1-3H3,(H,26,28) |
| InChIKey | ZMWOGCQXTKJAKL-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |