About (2-carbamoyl-4-methoxy-3-pyridinyl) acetate;1-cyclopentylpropan-2-yl propanoate;3-fluorophenol
(2-carbamoyl-4-methoxy-3-pyridinyl) acetate;1-cyclopentylpropan-2-yl propanoate;3-fluorophenol (PubChem CID 145114691) has the molecular formula C26H35FN2O7
and a molecular weight of 506.57 g/mol. Its IUPAC name is (2-carbamoyl-4-methoxy-3-pyridinyl) acetate;1-cyclopentylpropan-2-yl propanoate;3-fluorophenol.
Molecular Properties
| Compound Name | (2-carbamoyl-4-methoxy-3-pyridinyl) acetate;1-cyclopentylpropan-2-yl propanoate;3-fluorophenol |
| PubChem CID | 145114691 |
| Molecular Formula | C26H35FN2O7 |
| Molecular Weight | 506.57 g/mol |
| Exact Mass | 506.24 |
| IUPAC Name | (2-carbamoyl-4-methoxy-3-pyridinyl) acetate;1-cyclopentylpropan-2-yl propanoate;3-fluorophenol |
| SMILES | CCC(=O)OC(C)CC1CCCC1.COc1ccnc(C(N)=O)c1OC(C)=O.Oc1cccc(F)c1 |
| InChI | InChI=1S/C11H20O2.C9H10N2O4.C6H5FO/c1-3-11(12)13-9(2)8-10-6-4-5-7-10;1-5(12)15-8-6(14-2)3-4-11-7(8)9(10)13;7-5-2-1-3-6(8)4-5/h9-10H,3-8H2,1-2H3;3-4H,1-2H3,(H2,10,13);1-4,8H |
| InChIKey | HHZKBSOAZCMSIC-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 138.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 506.57 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze (2-carbamoyl-4-methoxy-3-pyridinyl) acetate;1-cyclopentylpropan-2-yl propanoate;3-fluorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-carbamoyl-4-methoxy-3-pyridinyl) acetate;1-cyclopentylpropan-2-yl propanoate;3-fluorophenol?
The IUPAC name of (2-carbamoyl-4-methoxy-3-pyridinyl) acetate;1-cyclopentylpropan-2-yl propanoate;3-fluorophenol (CID 145114691) is (2-carbamoyl-4-methoxy-3-pyridinyl) acetate;1-cyclopentylpropan-2-yl propanoate;3-fluorophenol.
What is the SMILES notation for (2-carbamoyl-4-methoxy-3-pyridinyl) acetate;1-cyclopentylpropan-2-yl propanoate;3-fluorophenol?
The canonical SMILES for (2-carbamoyl-4-methoxy-3-pyridinyl) acetate;1-cyclopentylpropan-2-yl propanoate;3-fluorophenol is CCC(=O)OC(C)CC1CCCC1.COc1ccnc(C(N)=O)c1OC(C)=O.Oc1cccc(F)c1.
What is the InChIKey of (2-carbamoyl-4-methoxy-3-pyridinyl) acetate;1-cyclopentylpropan-2-yl propanoate;3-fluorophenol?
The InChIKey is HHZKBSOAZCMSIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O2.C9H10N2O4.C6H5FO/c1-3-11(12)13-9(2)8-10-6-4-5-7-10;1-5(12)15-8-6(14-2)3-4-11-7(8)9(10)13;7-5-2-1-3-6(8)4-5/h9-10H,3-8H2,1-2H3;3-4H,1-2H3,(H2,10,13);1-4,8H.
What are the key properties of (2-carbamoyl-4-methoxy-3-pyridinyl) acetate;1-cyclopentylpropan-2-yl propanoate;3-fluorophenol?
(2-carbamoyl-4-methoxy-3-pyridinyl) acetate;1-cyclopentylpropan-2-yl propanoate;3-fluorophenol has a molecular weight of 506.57 g/mol, XLogP of 4.55, 7 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (2-carbamoyl-4-methoxy-3-pyridinyl) acetate;1-cyclopentylpropan-2-yl propanoate;3-fluorophenol is sourced from PubChem (CID 145114691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).