C25H34F2N2O8 — CID 145114555
(2-carbamoyl-4-methoxy-3-pyridinyl)oxymethyl acetate;2,5-difluorophenol;4-methylpentan-2-yl propanoate (PubChem CID 145114555) has the molecular formula C25H34F2N2O8 and a molecular weight of 528.55 g/mol. Its IUPAC name is (2-carbamoyl-4-methoxy-3-pyridinyl)oxymethyl acetate;2,5-difluorophenol;4-methylpentan-2-yl propanoate.
| Compound Name | (2-carbamoyl-4-methoxy-3-pyridinyl)oxymethyl acetate;2,5-difluorophenol;4-methylpentan-2-yl propanoate |
|---|---|
| PubChem CID | 145114555 |
| Molecular Formula | C25H34F2N2O8 |
| Molecular Weight | 528.55 g/mol |
| Exact Mass | 528.23 |
| IUPAC Name | (2-carbamoyl-4-methoxy-3-pyridinyl)oxymethyl acetate;2,5-difluorophenol;4-methylpentan-2-yl propanoate |
| SMILES | CCC(=O)OC(C)CC(C)C.COc1ccnc(C(N)=O)c1OCOC(C)=O.Oc1cc(F)ccc1F |
| InChI | InChI=1S/C10H12N2O5.C9H18O2.C6H4F2O/c1-6(13)16-5-17-9-7(15-2)3-4-12-8(9)10(11)14;1-5-9(10)11-8(4)6-7(2)3;7-4-1-2-5(8)6(9)3-4/h3-4H,5H2,1-2H3,(H2,11,14);7-8H,5-6H2,1-4H3;1-3,9H |
| InChIKey | PRCZBDWKXLAKCG-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 147.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.55 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|