C13H18N2O6 — CID 142237807
(2-carbamoyl-4-methoxy-3-pyridinyl)oxymethyl acetate;propanal (PubChem CID 142237807) has the molecular formula C13H18N2O6 and a molecular weight of 298.30 g/mol. Its IUPAC name is (2-carbamoyl-4-methoxy-3-pyridinyl)oxymethyl acetate;propanal.
| Compound Name | (2-carbamoyl-4-methoxy-3-pyridinyl)oxymethyl acetate;propanal |
|---|---|
| PubChem CID | 142237807 |
| Molecular Formula | C13H18N2O6 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | (2-carbamoyl-4-methoxy-3-pyridinyl)oxymethyl acetate;propanal |
| SMILES | CCC=O.COc1ccnc(C(N)=O)c1OCOC(C)=O |
| InChI | InChI=1S/C10H12N2O5.C3H6O/c1-6(13)16-5-17-9-7(15-2)3-4-12-8(9)10(11)14;1-2-3-4/h3-4H,5H2,1-2H3,(H2,11,14);3H,2H2,1H3 |
| InChIKey | PWWKIPWQJSCPPO-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 117.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|