C19H32N2O8 — CID 142237797
(2-carbamoyl-4-methoxy-3-pyridinyl)oxymethyl butanoate;ethane;methyl 3-methoxypropanoate (PubChem CID 142237797) has the molecular formula C19H32N2O8 and a molecular weight of 416.47 g/mol. Its IUPAC name is (2-carbamoyl-4-methoxy-3-pyridinyl)oxymethyl butanoate;ethane;methyl 3-methoxypropanoate.
| Compound Name | (2-carbamoyl-4-methoxy-3-pyridinyl)oxymethyl butanoate;ethane;methyl 3-methoxypropanoate |
|---|---|
| PubChem CID | 142237797 |
| Molecular Formula | C19H32N2O8 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | (2-carbamoyl-4-methoxy-3-pyridinyl)oxymethyl butanoate;ethane;methyl 3-methoxypropanoate |
| SMILES | CC.CCCC(=O)OCOc1c(OC)ccnc1C(N)=O.COCCC(=O)OC |
| InChI | InChI=1S/C12H16N2O5.C5H10O3.C2H6/c1-3-4-9(15)18-7-19-11-8(17-2)5-6-14-10(11)12(13)16;1-7-4-3-5(6)8-2;1-2/h5-6H,3-4,7H2,1-2H3,(H2,13,16);3-4H2,1-2H3;1-2H3 |
| InChIKey | YZUVQXPJADLNNR-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 136.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|