C26H29Cl2NO8 — CID 158090922
[(2S,3R)-3-(2,4-dichlorophenoxy)hex-5-en-2-yl] (2R)-4-[3-(acetyloxymethoxy)-4-methoxy-2-pyridinyl]-2-methyl-4-oxobutanoate (PubChem CID 158090922) has the molecular formula C26H29Cl2NO8 and a molecular weight of 554.42 g/mol. Its IUPAC name is [(2S,3R)-3-(2,4-dichlorophenoxy)hex-5-en-2-yl] (2R)-4-[3-(acetyloxymethoxy)-4-methoxy-2-pyridinyl]-2-methyl-4-oxobutanoate.
| Compound Name | [(2S,3R)-3-(2,4-dichlorophenoxy)hex-5-en-2-yl] (2R)-4-[3-(acetyloxymethoxy)-4-methoxy-2-pyridinyl]-2-methyl-4-oxobutanoate |
|---|---|
| PubChem CID | 158090922 |
| Molecular Formula | C26H29Cl2NO8 |
| Molecular Weight | 554.42 g/mol |
| Exact Mass | 553.13 |
| IUPAC Name | [(2S,3R)-3-(2,4-dichlorophenoxy)hex-5-en-2-yl] (2R)-4-[3-(acetyloxymethoxy)-4-methoxy-2-pyridinyl]-2-methyl-4-oxobutanoate |
| SMILES | C=CC[C@@H](Oc1ccc(Cl)cc1Cl)[C@H](C)OC(=O)[C@H](C)CC(=O)c1nccc(OC)c1OCOC(C)=O |
| InChI | InChI=1S/C26H29Cl2NO8/c1-6-7-21(37-22-9-8-18(27)13-19(22)28)16(3)36-26(32)15(2)12-20(31)24-25(35-14-34-17(4)30)23(33-5)10-11-29-24/h6,8-11,13,15-16,21H,1,7,12,14H2,2-5H3/t15-,16+,21-/m1/s1 |
| InChIKey | FOBXZAQFRCBWAT-VWKPWSFCSA-N |
| XLogP | 5.46 |
| TPSA | 110.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.42 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|