C31H36N2O7 — CID 121463006
(3-benzyl-4-phenylbutan-2-yl) (2S)-2-[[3-(acetyloxymethoxy)-4-methoxypyridine-2-carbonyl]amino]butanoate (PubChem CID 121463006) has the molecular formula C31H36N2O7 and a molecular weight of 548.64 g/mol. Its IUPAC name is (3-benzyl-4-phenylbutan-2-yl) (2S)-2-[[3-(acetyloxymethoxy)-4-methoxypyridine-2-carbonyl]amino]butanoate.
| Compound Name | (3-benzyl-4-phenylbutan-2-yl) (2S)-2-[[3-(acetyloxymethoxy)-4-methoxypyridine-2-carbonyl]amino]butanoate |
|---|---|
| PubChem CID | 121463006 |
| Molecular Formula | C31H36N2O7 |
| Molecular Weight | 548.64 g/mol |
| Exact Mass | 548.25 |
| IUPAC Name | (3-benzyl-4-phenylbutan-2-yl) (2S)-2-[[3-(acetyloxymethoxy)-4-methoxypyridine-2-carbonyl]amino]butanoate |
| SMILES | CC[C@H](NC(=O)c1nccc(OC)c1OCOC(C)=O)C(=O)OC(C)C(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C31H36N2O7/c1-5-26(33-30(35)28-29(39-20-38-22(3)34)27(37-4)16-17-32-28)31(36)40-21(2)25(18-23-12-8-6-9-13-23)19-24-14-10-7-11-15-24/h6-17,21,25-26H,5,18-20H2,1-4H3,(H,33,35)/t21?,26-/m0/s1 |
| InChIKey | GQUQFUKHJLFXAK-UQTORGHUSA-N |
| XLogP | 4.53 |
| TPSA | 113.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.64 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|