C14H10F2N4O2 — CID 87747601
3-[(2,4-difluorophenyl)methyl]-N-hydroxyimidazo[4,5-c]pyridine-4-carboxamide (PubChem CID 87747601) has the molecular formula C14H10F2N4O2 and a molecular weight of 304.26 g/mol. Its IUPAC name is 3-[(2,4-difluorophenyl)methyl]-N-hydroxyimidazo[4,5-c]pyridine-4-carboxamide.
| Compound Name | 3-[(2,4-difluorophenyl)methyl]-N-hydroxyimidazo[4,5-c]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 87747601 |
| Molecular Formula | C14H10F2N4O2 |
| Molecular Weight | 304.26 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 3-[(2,4-difluorophenyl)methyl]-N-hydroxyimidazo[4,5-c]pyridine-4-carboxamide |
| SMILES | O=C(NO)c1nccc2ncn(Cc3ccc(F)cc3F)c12 |
| InChI | InChI=1S/C14H10F2N4O2/c15-9-2-1-8(10(16)5-9)6-20-7-18-11-3-4-17-12(13(11)20)14(21)19-22/h1-5,7,22H,6H2,(H,19,21) |
| InChIKey | ORBPVHQJAALNFG-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.26 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|