C18H17F2N3O3 — CID 10316516
1-[(2,4-difluorophenyl)methyl]-3-(ethoxymethyl)-N-hydroxypyrrolo[2,3-c]pyridine-5-carboxamide (PubChem CID 10316516) has the molecular formula C18H17F2N3O3 and a molecular weight of 361.35 g/mol. Its IUPAC name is 1-[(2,4-difluorophenyl)methyl]-3-(ethoxymethyl)-N-hydroxypyrrolo[2,3-c]pyridine-5-carboxamide.
| Compound Name | 1-[(2,4-difluorophenyl)methyl]-3-(ethoxymethyl)-N-hydroxypyrrolo[2,3-c]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 10316516 |
| Molecular Formula | C18H17F2N3O3 |
| Molecular Weight | 361.35 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | 1-[(2,4-difluorophenyl)methyl]-3-(ethoxymethyl)-N-hydroxypyrrolo[2,3-c]pyridine-5-carboxamide |
| SMILES | CCOCc1cn(Cc2ccc(F)cc2F)c2cnc(C(=O)NO)cc12 |
| InChI | InChI=1S/C18H17F2N3O3/c1-2-26-10-12-9-23(8-11-3-4-13(19)5-15(11)20)17-7-21-16(6-14(12)17)18(24)22-25/h3-7,9,25H,2,8,10H2,1H3,(H,22,24) |
| InChIKey | HHZRMHMMADLTIE-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.35 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|