C20H20F2N2O3 — CID 143126134
1-[1-[(2,4-difluorophenyl)methyl]-3-(2-methoxyethoxymethyl)pyrrolo[2,3-c]pyridin-5-yl]ethenol (PubChem CID 143126134) has the molecular formula C20H20F2N2O3 and a molecular weight of 374.39 g/mol. Its IUPAC name is 1-[1-[(2,4-difluorophenyl)methyl]-3-(2-methoxyethoxymethyl)pyrrolo[2,3-c]pyridin-5-yl]ethenol.
| Compound Name | 1-[1-[(2,4-difluorophenyl)methyl]-3-(2-methoxyethoxymethyl)pyrrolo[2,3-c]pyridin-5-yl]ethenol |
|---|---|
| PubChem CID | 143126134 |
| Molecular Formula | C20H20F2N2O3 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 1-[1-[(2,4-difluorophenyl)methyl]-3-(2-methoxyethoxymethyl)pyrrolo[2,3-c]pyridin-5-yl]ethenol |
| SMILES | C=C(O)c1cc2c(COCCOC)cn(Cc3ccc(F)cc3F)c2cn1 |
| InChI | InChI=1S/C20H20F2N2O3/c1-13(25)19-8-17-15(12-27-6-5-26-2)11-24(20(17)9-23-19)10-14-3-4-16(21)7-18(14)22/h3-4,7-9,11,25H,1,5-6,10,12H2,2H3 |
| InChIKey | FMSKXDPGXSOXAG-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|